C12H11ClOS — CID 114287059
5-chloro-1,2,4,5-tetrahydro-[1]benzothiolo[2,3-d]oxepine (PubChem CID 114287059) has the molecular formula C12H11ClOS and a molecular weight of 238.74 g/mol. Its IUPAC name is 5-chloro-1,2,4,5-tetrahydro-[1]benzothiolo[2,3-d]oxepine.
| Compound Name | 5-chloro-1,2,4,5-tetrahydro-[1]benzothiolo[2,3-d]oxepine |
|---|---|
| PubChem CID | 114287059 |
| Molecular Formula | C12H11ClOS |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-chloro-1,2,4,5-tetrahydro-[1]benzothiolo[2,3-d]oxepine |
| SMILES | ClC1COCCc2c1sc1ccccc21 |
| InChI | InChI=1S/C12H11ClOS/c13-10-7-14-6-5-9-8-3-1-2-4-11(8)15-12(9)10/h1-4,10H,5-7H2 |
| InChIKey | IIJOQTCKSSBDLV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|