C10H8O2S — CID 14958807
2,3-dihydro-[1]benzothiolo[3,2-b]furan-3-ol (PubChem CID 14958807) has the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2,3-dihydro-[1]benzothiolo[3,2-b]furan-3-ol.
| Compound Name | 2,3-dihydro-[1]benzothiolo[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 14958807 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2,3-dihydro-[1]benzothiolo[3,2-b]furan-3-ol |
| SMILES | OC1COc2c1sc1ccccc21 |
| InChI | InChI=1S/C10H8O2S/c11-7-5-12-9-6-3-1-2-4-8(6)13-10(7)9/h1-4,7,11H,5H2 |
| InChIKey | ZNWBWVUNSDNRJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |