C30H20OS — CID 134852216
(1S,2E)-1-phenyl-2-[(4-phenylphenyl)methylidene]-1H-cyclopenta[b][1]benzothiol-3-one (PubChem CID 134852216) has the molecular formula C30H20OS and a molecular weight of 428.56 g/mol. Its IUPAC name is (1S,2E)-1-phenyl-2-[(4-phenylphenyl)methylidene]-1H-cyclopenta[b][1]benzothiol-3-one.
| Compound Name | (1S,2E)-1-phenyl-2-[(4-phenylphenyl)methylidene]-1H-cyclopenta[b][1]benzothiol-3-one |
|---|---|
| PubChem CID | 134852216 |
| Molecular Formula | C30H20OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (1S,2E)-1-phenyl-2-[(4-phenylphenyl)methylidene]-1H-cyclopenta[b][1]benzothiol-3-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)cc2)[C@H](c2ccccc2)c2c1sc1ccccc21 |
| InChI | InChI=1S/C30H20OS/c31-29-25(19-20-15-17-22(18-16-20)21-9-3-1-4-10-21)27(23-11-5-2-6-12-23)28-24-13-7-8-14-26(24)32-30(28)29/h1-19,27H/b25-19+/t27-/m0/s1 |
| InChIKey | KNDBJHJNMDWXCH-XIJDOWMKSA-N |
| XLogP | 7.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|