C23H18O — CID 1472122
(2E,3S)-2-[(4-methylphenyl)methylidene]-3-phenyl-3H-inden-1-one (PubChem CID 1472122) has the molecular formula C23H18O and a molecular weight of 310.40 g/mol. Its IUPAC name is (2E,3S)-2-[(4-methylphenyl)methylidene]-3-phenyl-3H-inden-1-one.
| Compound Name | (2E,3S)-2-[(4-methylphenyl)methylidene]-3-phenyl-3H-inden-1-one |
|---|---|
| PubChem CID | 1472122 |
| Molecular Formula | C23H18O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2E,3S)-2-[(4-methylphenyl)methylidene]-3-phenyl-3H-inden-1-one |
| SMILES | Cc1ccc(/C=C2/C(=O)c3ccccc3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18O/c1-16-11-13-17(14-12-16)15-21-22(18-7-3-2-4-8-18)19-9-5-6-10-20(19)23(21)24/h2-15,22H,1H3/b21-15+/t22-/m0/s1 |
| InChIKey | DEDMDBCEBICOKW-VAZXNAHHSA-N |
| XLogP | 5.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|