C14H10O — CID 14617627
8-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 14617627) has the molecular formula C14H10O and a molecular weight of 194.23 g/mol. Its IUPAC name is 8-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-one.
| Compound Name | 8-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 14617627 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 8-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | O=C1c2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C14H10O/c15-14-12-9-5-4-8-11(12)13(14)10-6-2-1-3-7-10/h1-9,13H |
| InChIKey | ZZBOLCDBGHUBEN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |