C15H11NO2 — CID 51552290
(3S)-3-phenyl-1H-quinoline-2,4-dione (PubChem CID 51552290) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (3S)-3-phenyl-1H-quinoline-2,4-dione.
| Compound Name | (3S)-3-phenyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 51552290 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (3S)-3-phenyl-1H-quinoline-2,4-dione |
| SMILES | O=C1Nc2ccccc2C(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H11NO2/c17-14-11-8-4-5-9-12(11)16-15(18)13(14)10-6-2-1-3-7-10/h1-9,13H,(H,16,18)/t13-/m0/s1 |
| InChIKey | IPYIJVQAAGLSKC-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|