C10H7N3O2 — CID 138115458
3a,5-dihydro-3H-imidazo[4,5-c]quinoline-2,4-dione (PubChem CID 138115458) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 3a,5-dihydro-3H-imidazo[4,5-c]quinoline-2,4-dione.
| Compound Name | 3a,5-dihydro-3H-imidazo[4,5-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 138115458 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 3a,5-dihydro-3H-imidazo[4,5-c]quinoline-2,4-dione |
| SMILES | O=C1N=C2c3ccccc3NC(=O)C2N1 |
| InChI | InChI=1S/C10H7N3O2/c14-9-8-7(12-10(15)13-8)5-3-1-2-4-6(5)11-9/h1-4,8H,(H,11,14)(H,13,15) |
| InChIKey | GSZXHTVSZRINJX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |