C12H10N2OS — CID 82376382
2-phenyl-2,4-dihydro-1H-thieno[3,4-b]pyrazin-3-one (PubChem CID 82376382) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-phenyl-2,4-dihydro-1H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | 2-phenyl-2,4-dihydro-1H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 82376382 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-phenyl-2,4-dihydro-1H-thieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1Nc2cscc2NC1c1ccccc1 |
| InChI | InChI=1S/C12H10N2OS/c15-12-11(8-4-2-1-3-5-8)13-9-6-16-7-10(9)14-12/h1-7,11,13H,(H,14,15) |
| InChIKey | KNOPGVKHSXANML-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |