C16H14FeN2O3 — CID 157433888
iron;methyl 3-oxo-2-phenyl-2,4-dihydro-1H-quinoxaline-6-carboxylate (PubChem CID 157433888) has the molecular formula C16H14FeN2O3 and a molecular weight of 338.14 g/mol. Its IUPAC name is iron;methyl 3-oxo-2-phenyl-2,4-dihydro-1H-quinoxaline-6-carboxylate.
| Compound Name | iron;methyl 3-oxo-2-phenyl-2,4-dihydro-1H-quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 157433888 |
| Molecular Formula | C16H14FeN2O3 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | iron;methyl 3-oxo-2-phenyl-2,4-dihydro-1H-quinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C(c1ccccc1)N2.[Fe] |
| InChI | InChI=1S/C16H14N2O3.Fe/c1-21-16(20)11-7-8-12-13(9-11)18-15(19)14(17-12)10-5-3-2-4-6-10;/h2-9,14,17H,1H3,(H,18,19); |
| InChIKey | BQWCGJHSLBWLAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|