C13H15NO3 — CID 86099334
methyl 2-oxo-3-propyl-1,3-dihydroindole-6-carboxylate (PubChem CID 86099334) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 2-oxo-3-propyl-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 2-oxo-3-propyl-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 86099334 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl 2-oxo-3-propyl-1,3-dihydroindole-6-carboxylate |
| SMILES | CCCC1C(=O)Nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C13H15NO3/c1-3-4-10-9-6-5-8(13(16)17-2)7-11(9)14-12(10)15/h5-7,10H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | HRSAJFRGUSABBJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |