C38H33N3O3 — CID 90853966
methyl 3-[N-[4-[(dibenzylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 90853966) has the molecular formula C38H33N3O3 and a molecular weight of 579.70 g/mol. Its IUPAC name is methyl 3-[N-[4-[(dibenzylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[(dibenzylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90853966 |
| Molecular Formula | C38H33N3O3 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | methyl 3-[N-[4-[(dibenzylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H33N3O3/c1-44-38(43)31-19-22-33-34(23-31)40-37(42)35(33)36(30-15-9-4-10-16-30)39-32-20-17-29(18-21-32)26-41(24-27-11-5-2-6-12-27)25-28-13-7-3-8-14-28/h2-23,35H,24-26H2,1H3,(H,40,42)/b39-36+ |
| InChIKey | XNMAOGVHPPWBLI-WQBMDMGNSA-N |
| XLogP | 7.53 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|