C29H32N4O3 — CID 90711367
methyl 3-[N-[4-[[3-(dimethylamino)propylamino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 90711367) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is methyl 3-[N-[4-[[3-(dimethylamino)propylamino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[[3-(dimethylamino)propylamino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 90711367 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | methyl 3-[N-[4-[[3-(dimethylamino)propylamino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(CNCCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3/c1-33(2)17-7-16-30-19-20-10-13-23(14-11-20)31-27(21-8-5-4-6-9-21)26-24-15-12-22(29(35)36-3)18-25(24)32-28(26)34/h4-6,8-15,18,26,30H,7,16-17,19H2,1-3H3,(H,32,34)/b31-27+ |
| InChIKey | YURWOLBPNWQZNW-TVKQRKNISA-N |
| XLogP | 4.37 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|