C24H19N3O4 — CID 91376806
methyl 3-[N-(4-carbamoylphenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 91376806) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 3-[N-(4-carbamoylphenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-(4-carbamoylphenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 91376806 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl 3-[N-(4-carbamoylphenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O4/c1-31-24(30)16-9-12-18-19(13-16)27-23(29)20(18)21(14-5-3-2-4-6-14)26-17-10-7-15(8-11-17)22(25)28/h2-13,20H,1H3,(H2,25,28)(H,27,29)/b26-21+ |
| InChIKey | LEPMACXFKCCPBY-YYADALCUSA-N |
| XLogP | 3.43 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|