C23H19N3O3 — CID 91410276
methyl 4-[[(6-amino-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate (PubChem CID 91410276) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 4-[[(6-amino-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate.
| Compound Name | methyl 4-[[(6-amino-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate |
|---|---|
| PubChem CID | 91410276 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | methyl 4-[[(6-amino-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C23H19N3O3/c1-29-23(28)15-7-10-17(11-8-15)25-21(14-5-3-2-4-6-14)20-18-12-9-16(24)13-19(18)26-22(20)27/h2-13,20H,24H2,1H3,(H,26,27)/b25-21+ |
| InChIKey | FSANPPUSLPQEIL-NJNXFGOHSA-N |
| XLogP | 3.91 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|