C26H24N2O5 — CID 91146602
ethyl 4-[[(5,6-dimethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate (PubChem CID 91146602) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is ethyl 4-[[(5,6-dimethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5,6-dimethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate |
|---|---|
| PubChem CID | 91146602 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl 4-[[(5,6-dimethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-4-33-26(30)17-10-12-18(13-11-17)27-24(16-8-6-5-7-9-16)23-19-14-21(31-2)22(32-3)15-20(19)28-25(23)29/h5-15,23H,4H2,1-3H3,(H,28,29)/b27-24+ |
| InChIKey | VWDGHVKRVRTLIO-SOYKGTTHSA-N |
| XLogP | 4.74 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|