C28H31N3O3 — CID 91117503
3-[N-[4-(3-aminopropyl)phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one (PubChem CID 91117503) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[N-[4-(3-aminopropyl)phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-(3-aminopropyl)phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91117503 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 3-[N-[4-(3-aminopropyl)phenyl]-C-phenylcarbonimidoyl]-5,6-diethoxy-1,3-dihydroindol-2-one |
| SMILES | CCOc1cc2c(cc1OCC)C(/C(=N/c1ccc(CCCN)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C28H31N3O3/c1-3-33-24-17-22-23(18-25(24)34-4-2)31-28(32)26(22)27(20-10-6-5-7-11-20)30-21-14-12-19(13-15-21)9-8-16-29/h5-7,10-15,17-18,26H,3-4,8-9,16,29H2,1-2H3,(H,31,32)/b30-27+ |
| InChIKey | JMBLBJPGAXOASH-KDJFERLWSA-N |
| XLogP | 5.23 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|