C29H32N4O4 — CID 91239726
3-amino-N-[4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide (PubChem CID 91239726) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3-amino-N-[4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide.
| Compound Name | 3-amino-N-[4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 91239726 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 3-amino-N-[4-[[(5,6-diethoxy-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
| SMILES | CCOc1cc2c(cc1OCC)C(/C(=N/c1ccc(N(C)C(=O)CCN)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C29H32N4O4/c1-4-36-24-17-22-23(18-25(24)37-5-2)32-29(35)27(22)28(19-9-7-6-8-10-19)31-20-11-13-21(14-12-20)33(3)26(34)15-16-30/h6-14,17-18,27H,4-5,15-16,30H2,1-3H3,(H,32,35)/b31-28+ |
| InChIKey | XCKMDMOARSONKE-CCFHIKDMSA-N |
| XLogP | 4.65 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|