C24H23N3O3 — CID 91141738
3-[N-[4-(aminomethyl)phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one (PubChem CID 91141738) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[N-[4-(aminomethyl)phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-(aminomethyl)phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91141738 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[N-[4-(aminomethyl)phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
| SMILES | COc1cc2c(cc1OC)C(/C(=N/c1ccc(CN)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C24H23N3O3/c1-29-20-12-18-19(13-21(20)30-2)27-24(28)22(18)23(16-6-4-3-5-7-16)26-17-10-8-15(14-25)9-11-17/h3-13,22H,14,25H2,1-2H3,(H,27,28)/b26-23+ |
| InChIKey | UDFUKVAIXHIOCF-WNAAXNPUSA-N |
| XLogP | 4.02 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|