C33H33N3O3 — CID 91331682
3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one (PubChem CID 91331682) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91331682 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
| SMILES | CCN(Cc1ccccc1)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C33H33N3O3/c1-4-36(21-23-11-7-5-8-12-23)22-24-15-17-26(18-16-24)34-32(25-13-9-6-10-14-25)31-27-19-29(38-2)30(39-3)20-28(27)35-33(31)37/h5-20,31H,4,21-22H2,1-3H3,(H,35,37)/b34-32+ |
| InChIKey | UDVLCNKSUKKWFW-NWBJSICCSA-N |
| XLogP | 6.58 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|