C25H23N3O3 — CID 90792619
7-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one (PubChem CID 90792619) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 7-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one.
| Compound Name | 7-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
|---|---|
| PubChem CID | 90792619 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 7-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-5,7-dihydro-[1,3]dioxolo[4,5-f]indol-6-one |
| SMILES | CN(C)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-28(2)14-16-8-10-18(11-9-16)26-24(17-6-4-3-5-7-17)23-19-12-21-22(31-15-30-21)13-20(19)27-25(23)29/h3-13,23H,14-15H2,1-2H3,(H,27,29)/b26-24+ |
| InChIKey | IBRXFMPNHPWNNW-SHHOIMCASA-N |
| XLogP | 4.33 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|