C30H30N4O2 — CID 123313143
5-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-4-methylpent-2-ynamide (PubChem CID 123313143) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 5-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-4-methylpent-2-ynamide.
| Compound Name | 5-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-4-methylpent-2-ynamide |
|---|---|
| PubChem CID | 123313143 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 5-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-4-methylpent-2-ynamide |
| SMILES | CC(C#CC(N)=O)Cc1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(CN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N4O2/c1-20(9-16-27(31)35)17-22-12-15-25-26(18-22)33-30(36)28(25)29(23-7-5-4-6-8-23)32-24-13-10-21(11-14-24)19-34(2)3/h4-8,10-15,18,20,28H,17,19H2,1-3H3,(H2,31,35)(H,33,36)/b32-29+ |
| InChIKey | YOXSYONMFKEZRC-UUDCSCGESA-N |
| XLogP | 4.27 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|