C29H28N4O3 — CID 91246720
3-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-N-(2-hydroxyethyl)prop-2-ynamide (PubChem CID 91246720) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-N-(2-hydroxyethyl)prop-2-ynamide.
| Compound Name | 3-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-N-(2-hydroxyethyl)prop-2-ynamide |
|---|---|
| PubChem CID | 91246720 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-6-yl]-N-(2-hydroxyethyl)prop-2-ynamide |
| SMILES | CN(C)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(C#CC(=O)NCCO)ccc32)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1-33(2)19-21-8-12-23(13-9-21)31-28(22-6-4-3-5-7-22)27-24-14-10-20(18-25(24)32-29(27)36)11-15-26(35)30-16-17-34/h3-10,12-14,18,27,34H,16-17,19H2,1-2H3,(H,30,35)(H,32,36)/b31-28+ |
| InChIKey | WWZJLOFNRPQAQA-CCFHIKDMSA-N |
| XLogP | 3.06 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|