C25H23N3O4 — CID 56996639
[3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate (PubChem CID 56996639) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is [3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate.
| Compound Name | [3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 56996639 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [3-[N-[4-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate |
| SMILES | CN(C)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc(OC(=O)O)cc32)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-28(2)15-16-8-10-18(11-9-16)26-23(17-6-4-3-5-7-17)22-20-14-19(32-25(30)31)12-13-21(20)27-24(22)29/h3-14,22H,15H2,1-2H3,(H,27,29)(H,30,31)/b26-23+ |
| InChIKey | VCMBTZIZTNCZFV-WNAAXNPUSA-N |
| XLogP | 4.66 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|