C22H15ClN2O4 — CID 56999891
[3-[N-(4-chlorophenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate (PubChem CID 56999891) has the molecular formula C22H15ClN2O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is [3-[N-(4-chlorophenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate.
| Compound Name | [3-[N-(4-chlorophenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 56999891 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [3-[N-(4-chlorophenyl)-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindol-5-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(/C(=N/c1ccc(Cl)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C22H15ClN2O4/c23-14-6-8-15(9-7-14)24-20(13-4-2-1-3-5-13)19-17-12-16(29-22(27)28)10-11-18(17)25-21(19)26/h1-12,19H,(H,25,26)(H,27,28)/b24-20+ |
| InChIKey | QGDCRHKNNFBONU-HIXSDJFHSA-N |
| XLogP | 5.25 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|