C21H14ClIN2O — CID 91458345
6-chloro-3-[N-(4-iodophenyl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91458345) has the molecular formula C21H14ClIN2O and a molecular weight of 472.71 g/mol. Its IUPAC name is 6-chloro-3-[N-(4-iodophenyl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-3-[N-(4-iodophenyl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91458345 |
| Molecular Formula | C21H14ClIN2O |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 6-chloro-3-[N-(4-iodophenyl)-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C1/C(=N/c1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H14ClIN2O/c22-14-6-11-17-18(12-14)25-21(26)19(17)20(13-4-2-1-3-5-13)24-16-9-7-15(23)8-10-16/h1-12,19H,(H,25,26)/b24-20+ |
| InChIKey | FYWZNFLVILUVRS-HIXSDJFHSA-N |
| XLogP | 5.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|