C28H30ClN3O — CID 90691181
6-chloro-3-[N-[4-[[di(propan-2-yl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 90691181) has the molecular formula C28H30ClN3O and a molecular weight of 460.02 g/mol. Its IUPAC name is 6-chloro-3-[N-[4-[[di(propan-2-yl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-3-[N-[4-[[di(propan-2-yl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90691181 |
| Molecular Formula | C28H30ClN3O |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 6-chloro-3-[N-[4-[[di(propan-2-yl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CC(C)N(Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(Cl)ccc32)cc1)C(C)C |
| InChI | InChI=1S/C28H30ClN3O/c1-18(2)32(19(3)4)17-20-10-13-23(14-11-20)30-27(21-8-6-5-7-9-21)26-24-15-12-22(29)16-25(24)31-28(26)33/h5-16,18-19,26H,17H2,1-4H3,(H,31,33)/b30-27+ |
| InChIKey | ORVHLNVXSBHVMO-KDJFERLWSA-N |
| XLogP | 6.82 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|