C26H26FN3O — CID 91495589
3-[N-[4-(diethylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 91495589) has the molecular formula C26H26FN3O and a molecular weight of 415.51 g/mol. Its IUPAC name is 3-[N-[4-(diethylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-(diethylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91495589 |
| Molecular Formula | C26H26FN3O |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[N-[4-(diethylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCN(CC)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C26H26FN3O/c1-3-30(4-2)17-18-10-13-21(14-11-18)28-25(19-8-6-5-7-9-19)24-22-15-12-20(27)16-23(22)29-26(24)31/h5-16,24H,3-4,17H2,1-2H3,(H,29,31)/b28-25+ |
| InChIKey | FICWIPUEBDFPNY-AZPGRJICSA-N |
| XLogP | 5.52 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|