C25H21FN2O3 — CID 91469207
methyl 3-[4-[C-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)-N-phenylcarbonimidoyl]phenyl]propanoate (PubChem CID 91469207) has the molecular formula C25H21FN2O3 and a molecular weight of 416.45 g/mol. Its IUPAC name is methyl 3-[4-[C-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)-N-phenylcarbonimidoyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[C-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)-N-phenylcarbonimidoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 91469207 |
| Molecular Formula | C25H21FN2O3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | methyl 3-[4-[C-(6-fluoro-2-oxo-1,3-dihydroindol-3-yl)-N-phenylcarbonimidoyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(/C(=N\c2ccccc2)C2C(=O)Nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C25H21FN2O3/c1-31-22(29)14-9-16-7-10-17(11-8-16)24(27-19-5-3-2-4-6-19)23-20-13-12-18(26)15-21(20)28-25(23)30/h2-8,10-13,15,23H,9,14H2,1H3,(H,28,30)/b27-24+ |
| InChIKey | OSZRMQUTSYQYAE-SOYKGTTHSA-N |
| XLogP | 4.79 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|