C26H26FN3O3 — CID 90822103
3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 90822103) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90822103 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1/C(=N/c1ccc(CN(CCO)CCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26FN3O3/c27-20-8-11-22-23(16-20)29-26(33)24(22)25(19-4-2-1-3-5-19)28-21-9-6-18(7-10-21)17-30(12-14-31)13-15-32/h1-11,16,24,31-32H,12-15,17H2,(H,29,33)/b28-25+ |
| InChIKey | VRXWZRHYNXKUGX-AZPGRJICSA-N |
| XLogP | 3.47 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|