C26H26N4O5 — CID 91214185
3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 91214185) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91214185 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[N-[4-[[bis(2-hydroxyethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1/C(=N/c1ccc(CN(CCO)CCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N4O5/c31-14-12-29(13-15-32)17-18-6-8-20(9-7-18)27-25(19-4-2-1-3-5-19)24-22-16-21(30(34)35)10-11-23(22)28-26(24)33/h1-11,16,24,31-32H,12-15,17H2,(H,28,33)/b27-25+ |
| InChIKey | XIJDBVNJFWOLAP-IMVLJIQESA-N |
| XLogP | 3.24 |
| TPSA | 128.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|