C34H32N4O5 — CID 90730896
tert-butyl N-benzyl-N-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methyl]carbamate (PubChem CID 90730896) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 90730896 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | tert-butyl N-benzyl-N-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C34H32N4O5/c1-34(2,3)43-33(40)37(21-23-10-6-4-7-11-23)22-24-14-16-26(17-15-24)35-31(25-12-8-5-9-13-25)30-28-20-27(38(41)42)18-19-29(28)36-32(30)39/h4-20,30H,21-22H2,1-3H3,(H,36,39)/b35-31+ |
| InChIKey | VRMYZAJHVZTFEW-JSLDZMDGSA-N |
| XLogP | 7.39 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|