C21H14BrN3O3 — CID 57035067
3-[N-(4-bromophenyl)-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 57035067) has the molecular formula C21H14BrN3O3 and a molecular weight of 436.27 g/mol. Its IUPAC name is 3-[N-(4-bromophenyl)-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-(4-bromophenyl)-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57035067 |
| Molecular Formula | C21H14BrN3O3 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 3-[N-(4-bromophenyl)-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1/C(=N/c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H14BrN3O3/c22-14-6-8-15(9-7-14)23-20(13-4-2-1-3-5-13)19-17-12-16(25(27)28)10-11-18(17)24-21(19)26/h1-12,19H,(H,24,26)/b23-20+ |
| InChIKey | CGEPSHIHBOVWQE-BSYVCWPDSA-N |
| XLogP | 5.21 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|