C23H20N4O5S — CID 90763758
N-methyl-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methanesulfonamide (PubChem CID 90763758) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is N-methyl-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methanesulfonamide.
| Compound Name | N-methyl-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90763758 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-methyl-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]methanesulfonamide |
| SMILES | CN(c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H20N4O5S/c1-26(33(2,31)32)17-10-8-16(9-11-17)24-22(15-6-4-3-5-7-15)21-19-14-18(27(29)30)12-13-20(19)25-23(21)28/h3-14,21H,1-2H3,(H,25,28)/b24-22+ |
| InChIKey | IWOXXFDTYYZQBX-ZNTNEXAZSA-N |
| XLogP | 3.85 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|