C29H32N6O6S — CID 91030242
N-[2-(dimethylamino)ethyl]-N-methyl-2-[N-methylsulfonyl-4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide (PubChem CID 91030242) has the molecular formula C29H32N6O6S and a molecular weight of 592.68 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-methyl-2-[N-methylsulfonyl-4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-methyl-2-[N-methylsulfonyl-4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
|---|---|
| PubChem CID | 91030242 |
| Molecular Formula | C29H32N6O6S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-methyl-2-[N-methylsulfonyl-4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
| SMILES | CN(C)CCN(C)C(=O)CN(c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H32N6O6S/c1-32(2)16-17-33(3)26(36)19-34(42(4,40)41)22-12-10-21(11-13-22)30-28(20-8-6-5-7-9-20)27-24-18-23(35(38)39)14-15-25(24)31-29(27)37/h5-15,18,27H,16-17,19H2,1-4H3,(H,31,37)/b30-28+ |
| InChIKey | CXPQQKKUGCOCKH-SJCQXOIGSA-N |
| XLogP | 3.24 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|