C26H25N5O6S — CID 90803954
N,N-dimethyl-2-[methyl-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetamide (PubChem CID 90803954) has the molecular formula C26H25N5O6S and a molecular weight of 535.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[methyl-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetamide.
| Compound Name | N,N-dimethyl-2-[methyl-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 90803954 |
| Molecular Formula | C26H25N5O6S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N,N-dimethyl-2-[methyl-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetamide |
| SMILES | CN(C)C(=O)CN(C)S(=O)(=O)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C26H25N5O6S/c1-29(2)23(32)16-30(3)38(36,37)20-12-9-18(10-13-20)27-25(17-7-5-4-6-8-17)24-21-15-19(31(34)35)11-14-22(21)28-26(24)33/h4-15,24H,16H2,1-3H3,(H,28,33)/b27-25+ |
| InChIKey | BIQWCIYSFJQGFX-IMVLJIQESA-N |
| XLogP | 3.16 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|