C30H26N4O3 — CID 91083091
3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 91083091) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91083091 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | CN(Cc1ccccc1)Cc1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C30H26N4O3/c1-33(19-21-8-4-2-5-9-21)20-22-12-14-24(15-13-22)31-29(23-10-6-3-7-11-23)28-26-18-25(34(36)37)16-17-27(26)32-30(28)35/h2-18,28H,19-20H2,1H3,(H,32,35)/b31-29+ |
| InChIKey | HOMMJVIHJXXYRW-OWWNRXNESA-N |
| XLogP | 6.08 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|