C25H19N5O4 — CID 57102702
5-nitro-3-[N-[4-[(5-oxo-1H-pyrazol-2-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 57102702) has the molecular formula C25H19N5O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 5-nitro-3-[N-[4-[(5-oxo-1H-pyrazol-2-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-3-[N-[4-[(5-oxo-1H-pyrazol-2-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57102702 |
| Molecular Formula | C25H19N5O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 5-nitro-3-[N-[4-[(5-oxo-1H-pyrazol-2-yl)methyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1/C(=N/c1ccc(Cn2ccc(=O)[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N5O4/c31-22-12-13-29(28-22)15-16-6-8-18(9-7-16)26-24(17-4-2-1-3-5-17)23-20-14-19(30(33)34)10-11-21(20)27-25(23)32/h1-14,23H,15H2,(H,27,32)(H,28,31)/b26-24+ |
| InChIKey | RPWSPJBRXFQQLE-SHHOIMCASA-N |
| XLogP | 3.99 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|