C28H26N4O4 — CID 57071582
5-nitro-3-[N-[4-[3-(2-oxopyrrolidin-1-yl)propyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 57071582) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 5-nitro-3-[N-[4-[3-(2-oxopyrrolidin-1-yl)propyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-3-[N-[4-[3-(2-oxopyrrolidin-1-yl)propyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57071582 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-nitro-3-[N-[4-[3-(2-oxopyrrolidin-1-yl)propyl]phenyl]-C-phenylcarbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1/C(=N/c1ccc(CCCN2CCCC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O4/c33-25-9-5-17-31(25)16-4-6-19-10-12-21(13-11-19)29-27(20-7-2-1-3-8-20)26-23-18-22(32(35)36)14-15-24(23)30-28(26)34/h1-3,7-8,10-15,18,26H,4-6,9,16-17H2,(H,30,34)/b29-27+ |
| InChIKey | IVNJIDYIAGCICG-ORIPQNMZSA-N |
| XLogP | 5.01 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|