C32H28N6O6 — CID 57283055
5-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-[4-[2-(2-oxopiperidin-1-yl)ethyl]phenyl]methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 57283055) has the molecular formula C32H28N6O6 and a molecular weight of 592.61 g/mol. Its IUPAC name is 5-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-[4-[2-(2-oxopiperidin-1-yl)ethyl]phenyl]methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-[4-[2-(2-oxopiperidin-1-yl)ethyl]phenyl]methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 57283055 |
| Molecular Formula | C32H28N6O6 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 5-[[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-[4-[2-(2-oxopiperidin-1-yl)ethyl]phenyl]methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(/N=C(\c3ccc(CCN4CCCCC4=O)cc3)C3C(=O)Nc4ccc([N+](=O)[O-])cc43)cc2)N1 |
| InChI | InChI=1S/C32H28N6O6/c39-27-3-1-2-15-37(27)16-14-19-4-8-21(9-5-19)29(28-24-18-23(38(43)44)12-13-25(24)34-31(28)41)33-22-10-6-20(7-11-22)17-26-30(40)36-32(42)35-26/h4-13,17-18,28H,1-3,14-16H2,(H,34,41)(H2,35,36,40,42)/b26-17?,33-29+ |
| InChIKey | HLPUCPYUSONCTJ-RYYDORMZSA-N |
| XLogP | 4.19 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|