C31H33N5O3 — CID 57042693
5-nitro-3-[C-[4-(2-piperidin-1-ylethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 57042693) has the molecular formula C31H33N5O3 and a molecular weight of 523.64 g/mol. Its IUPAC name is 5-nitro-3-[C-[4-(2-piperidin-1-ylethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-3-[C-[4-(2-piperidin-1-ylethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57042693 |
| Molecular Formula | C31H33N5O3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 5-nitro-3-[C-[4-(2-piperidin-1-ylethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1/C(=N/c1ccc2c(c1)CCNC2)c1ccc(CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C31H33N5O3/c37-31-29(27-19-26(36(38)39)10-11-28(27)34-31)30(33-25-9-8-24-20-32-14-12-23(24)18-25)22-6-4-21(5-7-22)13-17-35-15-2-1-3-16-35/h4-11,18-19,29,32H,1-3,12-17,20H2,(H,34,37)/b33-30+ |
| InChIKey | JJWWBKJWWITRRY-KKYHWDRJSA-N |
| XLogP | 5.13 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|