C26H25N5O3 — CID 57045150
3-[C-[4-(2-aminoethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 57045150) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[C-[4-(2-aminoethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[C-[4-(2-aminoethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57045150 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[C-[4-(2-aminoethyl)phenyl]-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | NCCc1ccc(/C(=N\c2ccc3c(c2)CCNC3)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C26H25N5O3/c27-11-9-16-1-3-17(4-2-16)25(29-20-6-5-19-15-28-12-10-18(19)13-20)24-22-14-21(31(33)34)7-8-23(22)30-26(24)32/h1-8,13-14,24,28H,9-12,15,27H2,(H,30,32)/b29-25+ |
| InChIKey | SHBPVQCFZZLNNB-XLVZBRSZSA-N |
| XLogP | 3.60 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|