C27H22N6O5 — CID 56993529
5-[[4-[[[4-(2-aminoethyl)phenyl]-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 56993529) has the molecular formula C27H22N6O5 and a molecular weight of 510.51 g/mol. Its IUPAC name is 5-[[4-[[[4-(2-aminoethyl)phenyl]-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[[[4-(2-aminoethyl)phenyl]-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56993529 |
| Molecular Formula | C27H22N6O5 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 5-[[4-[[[4-(2-aminoethyl)phenyl]-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)methylidene]amino]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | NCCc1ccc(/C(=N\c2ccc(C=C3NC(=O)NC3=O)cc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C27H22N6O5/c28-12-11-15-1-5-17(6-2-15)24(23-20-14-19(33(37)38)9-10-21(20)30-26(23)35)29-18-7-3-16(4-8-18)13-22-25(34)32-27(36)31-22/h1-10,13-14,23H,11-12,28H2,(H,30,35)(H2,31,32,34,36)/b22-13?,29-24+ |
| InChIKey | SUGZXMJCJSWVLY-CVUIIIQUSA-N |
| XLogP | 3.13 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|