C29H29N5O4 — CID 57065722
N-[3-[4-[C-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]phenyl]propyl]acetamide (PubChem CID 57065722) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[3-[4-[C-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]phenyl]propyl]acetamide.
| Compound Name | N-[3-[4-[C-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 57065722 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-[3-[4-[C-(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbonimidoyl]phenyl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1ccc(/C(=N\c2ccc3c(c2)CCNC3)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C29H29N5O4/c1-18(35)31-13-2-3-19-4-6-20(7-5-19)28(32-23-9-8-22-17-30-14-12-21(22)15-23)27-25-16-24(34(37)38)10-11-26(25)33-29(27)36/h4-11,15-16,27,30H,2-3,12-14,17H2,1H3,(H,31,35)(H,33,36)/b32-28+ |
| InChIKey | ZKZOXGYJUCEPPF-VEWQFJOQSA-N |
| XLogP | 4.17 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|