C31H30N6O3 — CID 57088229
3-[N-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-C-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 57088229) has the molecular formula C31H30N6O3 and a molecular weight of 534.62 g/mol. Its IUPAC name is 3-[N-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-C-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-C-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57088229 |
| Molecular Formula | C31H30N6O3 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 3-[N-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-C-[4-(piperidin-1-ylmethyl)phenyl]carbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | Cc1ncc(-c2ccc(/N=C(\c3ccc(CN4CCCCC4)cc3)C3C(=O)Nc4ccc([N+](=O)[O-])cc43)cc2)[nH]1 |
| InChI | InChI=1S/C31H30N6O3/c1-20-32-18-28(33-20)22-9-11-24(12-10-22)34-30(23-7-5-21(6-8-23)19-36-15-3-2-4-16-36)29-26-17-25(37(39)40)13-14-27(26)35-31(29)38/h5-14,17-18,29H,2-4,15-16,19H2,1H3,(H,32,33)(H,35,38)/b34-30+ |
| InChIKey | WCTAKLAAOSESEA-VBMGMRCRSA-N |
| XLogP | 6.14 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|