C27H23N5O3 — CID 57242911
5-nitro-3-[C-phenyl-N-[4-(2-propyl-1H-imidazol-5-yl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 57242911) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is 5-nitro-3-[C-phenyl-N-[4-(2-propyl-1H-imidazol-5-yl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-nitro-3-[C-phenyl-N-[4-(2-propyl-1H-imidazol-5-yl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57242911 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 5-nitro-3-[C-phenyl-N-[4-(2-propyl-1H-imidazol-5-yl)phenyl]carbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | CCCc1ncc(-c2ccc(/N=C(\c3ccccc3)C3C(=O)Nc4ccc([N+](=O)[O-])cc43)cc2)[nH]1 |
| InChI | InChI=1S/C27H23N5O3/c1-2-6-24-28-16-23(30-24)17-9-11-19(12-10-17)29-26(18-7-4-3-5-8-18)25-21-15-20(32(34)35)13-14-22(21)31-27(25)33/h3-5,7-16,25H,2,6H2,1H3,(H,28,30)(H,31,33)/b29-26+ |
| InChIKey | KYWPIIGHXHPLBR-PBBVDAKRSA-N |
| XLogP | 5.79 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|