C24H17N5O3S — CID 57125182
3-[N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 57125182) has the molecular formula C24H17N5O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is 3-[N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 57125182 |
| Molecular Formula | C24H17N5O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-C-phenylcarbonimidoyl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | Nc1nc(-c2ccc(/N=C(\c3ccccc3)C3C(=O)Nc4ccc([N+](=O)[O-])cc43)cc2)cs1 |
| InChI | InChI=1S/C24H17N5O3S/c25-24-28-20(13-33-24)14-6-8-16(9-7-14)26-22(15-4-2-1-3-5-15)21-18-12-17(29(31)32)10-11-19(18)27-23(21)30/h1-13,21H,(H2,25,28)(H,27,30)/b26-22+ |
| InChIKey | NZVXTCJOPWYYQN-XTCLZLMSSA-N |
| XLogP | 5.16 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|