C24H21N3O5S — CID 90788794
2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetic acid (PubChem CID 90788794) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetic acid.
| Compound Name | 2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetic acid |
|---|---|
| PubChem CID | 90788794 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetic acid |
| SMILES | CS(=O)(=O)N(CC(=O)O)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-33(31,32)27(15-21(28)29)18-13-11-17(12-14-18)25-23(16-7-3-2-4-8-16)22-19-9-5-6-10-20(19)26-24(22)30/h2-14,22H,15H2,1H3,(H,26,30)(H,28,29)/b25-23+ |
| InChIKey | UGXPPAUDMMJFLP-WJTDDFOZSA-N |
| XLogP | 3.39 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|