C25H24N4O4S — CID 91424973
N-methyl-2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide (PubChem CID 91424973) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-methyl-2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide.
| Compound Name | N-methyl-2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
|---|---|
| PubChem CID | 91424973 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-methyl-2-[N-methylsulfonyl-4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]anilino]acetamide |
| SMILES | CNC(=O)CN(c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H24N4O4S/c1-26-22(30)16-29(34(2,32)33)19-14-12-18(13-15-19)27-24(17-8-4-3-5-9-17)23-20-10-6-7-11-21(20)28-25(23)31/h3-15,23H,16H2,1-2H3,(H,26,30)(H,28,31)/b27-24+ |
| InChIKey | DICDWWNAPSCZFP-SOYKGTTHSA-N |
| XLogP | 3.06 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|