C29H30N4O2 — CID 91142119
N-methyl-N-[4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-2-piperidin-1-ylacetamide (PubChem CID 91142119) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-methyl-N-[4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-methyl-N-[4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 91142119 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-methyl-N-[4-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]-2-piperidin-1-ylacetamide |
| SMILES | CN(C(=O)CN1CCCCC1)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H30N4O2/c1-32(26(34)20-33-18-8-3-9-19-33)23-16-14-22(15-17-23)30-28(21-10-4-2-5-11-21)27-24-12-6-7-13-25(24)31-29(27)35/h2,4-7,10-17,27H,3,8-9,18-20H2,1H3,(H,31,35)/b30-28+ |
| InChIKey | QKDMKAFWJGFPIF-SJCQXOIGSA-N |
| XLogP | 4.99 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|