C26H22N4O5S — CID 91123802
methyl 3-[N-[4-[cyanomethyl(methylsulfonyl)amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate (PubChem CID 91123802) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is methyl 3-[N-[4-[cyanomethyl(methylsulfonyl)amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate.
| Compound Name | methyl 3-[N-[4-[cyanomethyl(methylsulfonyl)amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| PubChem CID | 91123802 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | methyl 3-[N-[4-[cyanomethyl(methylsulfonyl)amino]phenyl]-C-phenylcarbonimidoyl]-2-oxo-1,3-dihydroindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)C2/C(=N/c1ccc(N(CC#N)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H22N4O5S/c1-35-26(32)18-8-13-21-22(16-18)29-25(31)23(21)24(17-6-4-3-5-7-17)28-19-9-11-20(12-10-19)30(15-14-27)36(2,33)34/h3-13,16,23H,15H2,1-2H3,(H,29,31)/b28-24+ |
| InChIKey | ADJGWMJLHSFBPS-ZZIIXHQDSA-N |
| XLogP | 3.62 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|